C16H24Cl2N3O+ — CID 7304408
1-(3,4-dichlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)urea (PubChem CID 7304408) has the molecular formula C16H24Cl2N3O+ and a molecular weight of 345.29 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)urea |
|---|---|
| PubChem CID | 7304408 |
| Molecular Formula | C16H24Cl2N3O+ |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)Nc2ccc(Cl)c(Cl)c2)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C16H23Cl2N3O/c1-15(2)8-11(9-16(3,4)21-15)20-14(22)19-10-5-6-12(17)13(18)7-10/h5-7,11,21H,8-9H2,1-4H3,(H2,19,20,22)/p+1 |
| InChIKey | FYQRCRGUPBVYTH-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 57.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |