C18H28N3OS+ — CID 2538448
N-[4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)carbamothioyl]phenyl]acetamide (PubChem CID 2538448) has the molecular formula C18H28N3OS+ and a molecular weight of 334.51 g/mol. Its IUPAC name is N-[4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)carbamothioyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)carbamothioyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2538448 |
| Molecular Formula | C18H28N3OS+ |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)carbamothioyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=S)NC2CC(C)(C)[NH2+]C(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H27N3OS/c1-12(22)19-14-8-6-13(7-9-14)16(23)20-15-10-17(2,3)21-18(4,5)11-15/h6-9,15,21H,10-11H2,1-5H3,(H,19,22)(H,20,23)/p+1 |
| InChIKey | NDVKOVZAVBYGSI-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 57.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|