C13H18ClN3O — CID 115600288
6-chloro-N-(1,3-dimethylpiperidin-4-yl)pyridine-2-carboxamide (PubChem CID 115600288) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-chloro-N-(1,3-dimethylpiperidin-4-yl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(1,3-dimethylpiperidin-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115600288 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-chloro-N-(1,3-dimethylpiperidin-4-yl)pyridine-2-carboxamide |
| SMILES | CC1CN(C)CCC1NC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O/c1-9-8-17(2)7-6-10(9)16-13(18)11-4-3-5-12(14)15-11/h3-5,9-10H,6-8H2,1-2H3,(H,16,18) |
| InChIKey | ZQCXKDAINKKPFP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|