C13H14N4O4 — CID 115601911
propan-2-yl 2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetate (PubChem CID 115601911) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is propan-2-yl 2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 115601911 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | propan-2-yl 2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetate |
| SMILES | CC(C)OC(=O)Cn1cnc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C13H14N4O4/c1-9(2)21-12(18)7-16-8-14-13(15-16)10-3-5-11(6-4-10)17(19)20/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | GZGBXNAIXJVONB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|