C12H21F3N2S — CID 115603238
N-(thian-4-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 115603238) has the molecular formula C12H21F3N2S and a molecular weight of 282.38 g/mol. Its IUPAC name is N-(thian-4-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(thian-4-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115603238 |
| Molecular Formula | C12H21F3N2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(thian-4-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(NC2CCSCC2)CC1 |
| InChI | InChI=1S/C12H21F3N2S/c13-12(14,15)9-17-5-1-10(2-6-17)16-11-3-7-18-8-4-11/h10-11,16H,1-9H2 |
| InChIKey | LNWKPOXFGFJLHD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |