C14H19BrN4O — CID 115603586
4-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-ethylpyrrole-2-carboxamide (PubChem CID 115603586) has the molecular formula C14H19BrN4O and a molecular weight of 339.24 g/mol. Its IUPAC name is 4-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115603586 |
| Molecular Formula | C14H19BrN4O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C14H19BrN4O/c1-5-19-8-9(15)6-10(19)13(20)16-12-7-11(17-18-12)14(2,3)4/h6-8H,5H2,1-4H3,(H2,16,17,18,20) |
| InChIKey | VFUGYEDWERSNAD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |