C11H15ClN2OS — CID 115604079
2-chloro-N-(3-methylsulfanylbutyl)pyridine-4-carboxamide (PubChem CID 115604079) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 2-chloro-N-(3-methylsulfanylbutyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(3-methylsulfanylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115604079 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-chloro-N-(3-methylsulfanylbutyl)pyridine-4-carboxamide |
| SMILES | CSC(C)CCNC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2OS/c1-8(16-2)3-5-14-11(15)9-4-6-13-10(12)7-9/h4,6-8H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | LCQQTQQHJBDKQH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|