C9H8ClN3O — CID 14054594
2-chloro-N-(2-cyanoethyl)pyridine-4-carboxamide (PubChem CID 14054594) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 14054594 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)pyridine-4-carboxamide |
| SMILES | N#CCCNC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H8ClN3O/c10-8-6-7(2-5-12-8)9(14)13-4-1-3-11/h2,5-6H,1,4H2,(H,13,14) |
| InChIKey | CBHOVWWXFMAQCV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|