C11H11ClN2O — CID 115977384
2-chloro-N-pent-3-ynylpyridine-4-carboxamide (PubChem CID 115977384) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-chloro-N-pent-3-ynylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-pent-3-ynylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 115977384 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-chloro-N-pent-3-ynylpyridine-4-carboxamide |
| SMILES | CC#CCCNC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O/c1-2-3-4-6-14-11(15)9-5-7-13-10(12)8-9/h5,7-8H,4,6H2,1H3,(H,14,15) |
| InChIKey | FRLDRUOKFUMBMR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|