C16H9Cl2NO — CID 115604879
(2,4-dichlorophenyl)-quinolin-8-ylmethanone (PubChem CID 115604879) has the molecular formula C16H9Cl2NO and a molecular weight of 302.16 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-quinolin-8-ylmethanone.
| Compound Name | (2,4-dichlorophenyl)-quinolin-8-ylmethanone |
|---|---|
| PubChem CID | 115604879 |
| Molecular Formula | C16H9Cl2NO |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (2,4-dichlorophenyl)-quinolin-8-ylmethanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)c1cccc2cccnc12 |
| InChI | InChI=1S/C16H9Cl2NO/c17-11-6-7-12(14(18)9-11)16(20)13-5-1-3-10-4-2-8-19-15(10)13/h1-9H |
| InChIKey | RFEURLGUWNPZCC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |