C16H21N3OS — CID 115608401
N,N-diethyl-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]acetamide (PubChem CID 115608401) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N,N-diethyl-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 115608401 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N,N-diethyl-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-19(4-2)16(20)11-17-10-15-18-14(12-21-15)13-8-6-5-7-9-13/h5-9,12,17H,3-4,10-11H2,1-2H3 |
| InChIKey | XQKPJORXVHBUIM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |