C14H23NO4S — CID 115609423
2-[(1-methoxy-2-methylpropan-2-yl)amino]-1-(4-methylsulfonylphenyl)ethanol (PubChem CID 115609423) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[(1-methoxy-2-methylpropan-2-yl)amino]-1-(4-methylsulfonylphenyl)ethanol.
| Compound Name | 2-[(1-methoxy-2-methylpropan-2-yl)amino]-1-(4-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 115609423 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(1-methoxy-2-methylpropan-2-yl)amino]-1-(4-methylsulfonylphenyl)ethanol |
| SMILES | COCC(C)(C)NCC(O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23NO4S/c1-14(2,10-19-3)15-9-13(16)11-5-7-12(8-6-11)20(4,17)18/h5-8,13,15-16H,9-10H2,1-4H3 |
| InChIKey | BFQPLYOAYQYZEZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |