C7H14F2N2S — CID 115611441
1-(2,2-difluoroethyl)-1-methyl-3-propylthiourea (PubChem CID 115611441) has the molecular formula C7H14F2N2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-1-methyl-3-propylthiourea.
| Compound Name | 1-(2,2-difluoroethyl)-1-methyl-3-propylthiourea |
|---|---|
| PubChem CID | 115611441 |
| Molecular Formula | C7H14F2N2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-1-methyl-3-propylthiourea |
| SMILES | CCCNC(=S)N(C)CC(F)F |
| InChI | InChI=1S/C7H14F2N2S/c1-3-4-10-7(12)11(2)5-6(8)9/h6H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | MRCRVMNYFIFKRH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|