About 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea
3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea (PubChem CID 116510300) has the molecular formula C9H16F2N2S
and a molecular weight of 222.30 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea |
| PubChem CID | 116510300 |
| Molecular Formula | C9H16F2N2S |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea |
| SMILES | CN(CC(F)F)C(=S)NC1CCCC1 |
| InChI | InChI=1S/C9H16F2N2S/c1-13(6-8(10)11)9(14)12-7-4-2-3-5-7/h7-8H,2-6H2,1H3,(H,12,14) |
| InChIKey | HMFUHEDVOXHZKX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea?
The IUPAC name of 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea (CID 116510300) is 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea.
What is the SMILES notation for 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea?
The canonical SMILES for 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea is CN(CC(F)F)C(=S)NC1CCCC1.
What is the InChIKey of 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea?
The InChIKey is HMFUHEDVOXHZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2S/c1-13(6-8(10)11)9(14)12-7-4-2-3-5-7/h7-8H,2-6H2,1H3,(H,12,14).
What are the key properties of 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea?
3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea has a molecular weight of 222.30 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea is sourced from PubChem (CID 116510300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).