C9H16F2N2S — CID 116510300
3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea (PubChem CID 116510300) has the molecular formula C9H16F2N2S and a molecular weight of 222.30 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea.
| Compound Name | 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea |
|---|---|
| PubChem CID | 116510300 |
| Molecular Formula | C9H16F2N2S |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-cyclopentyl-1-(2,2-difluoroethyl)-1-methylthiourea |
| SMILES | CN(CC(F)F)C(=S)NC1CCCC1 |
| InChI | InChI=1S/C9H16F2N2S/c1-13(6-8(10)11)9(14)12-7-4-2-3-5-7/h7-8H,2-6H2,1H3,(H,12,14) |
| InChIKey | HMFUHEDVOXHZKX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|