C12H16BrClFNS — CID 115615242
N-[(3-bromo-4-fluorophenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride (PubChem CID 115615242) has the molecular formula C12H16BrClFNS and a molecular weight of 340.69 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 115615242 |
| Molecular Formula | C12H16BrClFNS |
| Molecular Weight | 340.69 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride |
| SMILES | C=CCSCCNCc1ccc(F)c(Br)c1.Cl |
| InChI | InChI=1S/C12H15BrFNS.ClH/c1-2-6-16-7-5-15-9-10-3-4-12(14)11(13)8-10;/h2-4,8,15H,1,5-7,9H2;1H |
| InChIKey | BMJYSMROTBOUDE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|