C12H18ClN3O — CID 115617505
2-[4-(furan-3-ylmethylamino)piperidin-1-yl]acetonitrile;hydrochloride (PubChem CID 115617505) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-[4-(furan-3-ylmethylamino)piperidin-1-yl]acetonitrile;hydrochloride.
| Compound Name | 2-[4-(furan-3-ylmethylamino)piperidin-1-yl]acetonitrile;hydrochloride |
|---|---|
| PubChem CID | 115617505 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[4-(furan-3-ylmethylamino)piperidin-1-yl]acetonitrile;hydrochloride |
| SMILES | Cl.N#CCN1CCC(NCc2ccoc2)CC1 |
| InChI | InChI=1S/C12H17N3O.ClH/c13-4-7-15-5-1-12(2-6-15)14-9-11-3-8-16-10-11;/h3,8,10,12,14H,1-2,5-7,9H2;1H |
| InChIKey | FPLBRYYFZNJNOQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|