C13H21ClN2O — CID 115618466
2-(benzylamino)-N,N,2-trimethylpropanamide;hydrochloride (PubChem CID 115618466) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-(benzylamino)-N,N,2-trimethylpropanamide;hydrochloride.
| Compound Name | 2-(benzylamino)-N,N,2-trimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 115618466 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(benzylamino)-N,N,2-trimethylpropanamide;hydrochloride |
| SMILES | CN(C)C(=O)C(C)(C)NCc1ccccc1.Cl |
| InChI | InChI=1S/C13H20N2O.ClH/c1-13(2,12(16)15(3)4)14-10-11-8-6-5-7-9-11;/h5-9,14H,10H2,1-4H3;1H |
| InChIKey | OLIXFIOOWDOUKE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |