C32H30O4S — CID 11562540
2-benzyl-2-(3-tritylsulfanylpropyl)propanedioic acid (PubChem CID 11562540) has the molecular formula C32H30O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-benzyl-2-(3-tritylsulfanylpropyl)propanedioic acid.
| Compound Name | 2-benzyl-2-(3-tritylsulfanylpropyl)propanedioic acid |
|---|---|
| PubChem CID | 11562540 |
| Molecular Formula | C32H30O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-benzyl-2-(3-tritylsulfanylpropyl)propanedioic acid |
| SMILES | O=C(O)C(CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H30O4S/c33-29(34)31(30(35)36,24-25-14-5-1-6-15-25)22-13-23-37-32(26-16-7-2-8-17-26,27-18-9-3-10-19-27)28-20-11-4-12-21-28/h1-12,14-21H,13,22-24H2,(H,33,34)(H,35,36) |
| InChIKey | JWFAFKYEUDBFMP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|