C12H17NOS — CID 115628193
3-ethyl-N-[(E)-pent-3-enyl]thiophene-2-carboxamide (PubChem CID 115628193) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-ethyl-N-[(E)-pent-3-enyl]thiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-[(E)-pent-3-enyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115628193 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-ethyl-N-[(E)-pent-3-enyl]thiophene-2-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1sccc1CC |
| InChI | InChI=1S/C12H17NOS/c1-3-5-6-8-13-12(14)11-10(4-2)7-9-15-11/h3,5,7,9H,4,6,8H2,1-2H3,(H,13,14)/b5-3+ |
| InChIKey | FKKFFNSZWUJXPJ-HWKANZROSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|