C12H12F3N3O — CID 115629510
2-[(1-hydroxycyclobutyl)methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 115629510) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-[(1-hydroxycyclobutyl)methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[(1-hydroxycyclobutyl)methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 115629510 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[(1-hydroxycyclobutyl)methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1NCC1(O)CCC1 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)9-3-2-8(6-16)10(18-9)17-7-11(19)4-1-5-11/h2-3,19H,1,4-5,7H2,(H,17,18) |
| InChIKey | PRLYWIWVOAXDEU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |