C13H23F3N2O — CID 115630990
4-tert-butyl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide (PubChem CID 115630990) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 115630990 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-tert-butyl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide |
| SMILES | CC(C)(C)C1CCCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2O/c1-12(2,3)10-5-4-7-18(8-6-10)11(19)17-9-13(14,15)16/h10H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | IGYZFIOSSJGYTF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |