C12H16N4 — CID 115631606
5,6-dimethyl-3-(pent-4-en-2-ylamino)pyridazine-4-carbonitrile (PubChem CID 115631606) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 5,6-dimethyl-3-(pent-4-en-2-ylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-(pent-4-en-2-ylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 115631606 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 5,6-dimethyl-3-(pent-4-en-2-ylamino)pyridazine-4-carbonitrile |
| SMILES | C=CCC(C)Nc1nnc(C)c(C)c1C#N |
| InChI | InChI=1S/C12H16N4/c1-5-6-8(2)14-12-11(7-13)9(3)10(4)15-16-12/h5,8H,1,6H2,2-4H3,(H,14,16) |
| InChIKey | IURLOIOJWDHQNU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|