C9H14N2O2 — CID 115631668
2-[1,2-oxazol-5-ylmethyl(prop-2-enyl)amino]ethanol (PubChem CID 115631668) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-[1,2-oxazol-5-ylmethyl(prop-2-enyl)amino]ethanol.
| Compound Name | 2-[1,2-oxazol-5-ylmethyl(prop-2-enyl)amino]ethanol |
|---|---|
| PubChem CID | 115631668 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-[1,2-oxazol-5-ylmethyl(prop-2-enyl)amino]ethanol |
| SMILES | C=CCN(CCO)Cc1ccno1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-5-11(6-7-12)8-9-3-4-10-13-9/h2-4,12H,1,5-8H2 |
| InChIKey | VWPSCIIJILYEOE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|