C11H14ClN3S — CID 115641531
N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-2-methylsulfanylethanamine (PubChem CID 115641531) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 115641531 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1cnc2ccc(Cl)cn12 |
| InChI | InChI=1S/C11H14ClN3S/c1-16-5-4-13-6-10-7-14-11-3-2-9(12)8-15(10)11/h2-3,7-8,13H,4-6H2,1H3 |
| InChIKey | YUILFJXGALIJOV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|