C11H20N2O — CID 115642104
3-(2-bicyclo[2.2.1]heptanyl)-1-ethyl-1-methylurea (PubChem CID 115642104) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 115642104 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)NC1CC2CCC1C2 |
| InChI | InChI=1S/C11H20N2O/c1-3-13(2)11(14)12-10-7-8-4-5-9(10)6-8/h8-10H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | AKKNCIYZACHBHU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |