C11H22O3S — CID 115643070
1-(3,4-dimethylcyclohexyl)-2-methylsulfonylethanol (PubChem CID 115643070) has the molecular formula C11H22O3S and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylethanol.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 115643070 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylethanol |
| SMILES | CC1CCC(C(O)CS(C)(=O)=O)CC1C |
| InChI | InChI=1S/C11H22O3S/c1-8-4-5-10(6-9(8)2)11(12)7-15(3,13)14/h8-12H,4-7H2,1-3H3 |
| InChIKey | XQYPBCGIVUUABX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |