C10H14N2O2 — CID 11564647
(8aR)-3,3-dideuterio-8a-prop-2-enyl-2,6,7,8-tetrahydropyrrolo[1,2-a](415N)pyrazine-1,4-dione (PubChem CID 11564647) has the molecular formula C10H14N2O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is (8aR)-3,3-dideuterio-8a-prop-2-enyl-2,6,7,8-tetrahydropyrrolo[1,2-a](415N)pyrazine-1,4-dione.
| Compound Name | (8aR)-3,3-dideuterio-8a-prop-2-enyl-2,6,7,8-tetrahydropyrrolo[1,2-a](415N)pyrazine-1,4-dione |
|---|---|
| PubChem CID | 11564647 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (8aR)-3,3-dideuterio-8a-prop-2-enyl-2,6,7,8-tetrahydropyrrolo[1,2-a](415N)pyrazine-1,4-dione |
| SMILES | [2H]C1([2H])[15NH]C(=O)[C@]2(CC=C)CCCN2C1=O |
| InChI | InChI=1S/C10H14N2O2/c1-2-4-10-5-3-6-12(10)8(13)7-11-9(10)14/h2H,1,3-7H2,(H,11,14)/t10-/m0/s1/i7D2,11+1 |
| InChIKey | WVKCGUOWPZAROG-ALRAAJKBSA-N |
| XLogP | 0.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|