C16H24N2O — CID 24870090
3a,4,4-trimethyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]indol-2-one (PubChem CID 24870090) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3a,4,4-trimethyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]indol-2-one.
| Compound Name | 3a,4,4-trimethyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 24870090 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3a,4,4-trimethyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]indol-2-one |
| SMILES | C=CCN1C(=O)CN2C3=C(CCCC3)C(C)(C)C12C |
| InChI | InChI=1S/C16H24N2O/c1-5-10-17-14(19)11-18-13-9-7-6-8-12(13)15(2,3)16(17,18)4/h5H,1,6-11H2,2-4H3 |
| InChIKey | CYLZFZDQWPHBEX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|