C19H28N4O — CID 135126719
3a,6a-dimethyl-2-methylidene-1,3,4,6-tetrakis(prop-2-enyl)imidazo[4,5-d]imidazol-5-one (PubChem CID 135126719) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3a,6a-dimethyl-2-methylidene-1,3,4,6-tetrakis(prop-2-enyl)imidazo[4,5-d]imidazol-5-one.
| Compound Name | 3a,6a-dimethyl-2-methylidene-1,3,4,6-tetrakis(prop-2-enyl)imidazo[4,5-d]imidazol-5-one |
|---|---|
| PubChem CID | 135126719 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3a,6a-dimethyl-2-methylidene-1,3,4,6-tetrakis(prop-2-enyl)imidazo[4,5-d]imidazol-5-one |
| SMILES | C=CCN1C(=C)N(CC=C)C2(C)N(CC=C)C(=O)N(CC=C)C12C |
| InChI | InChI=1S/C19H28N4O/c1-8-12-20-16(5)21(13-9-2)19(7)18(20,6)22(14-10-3)17(24)23(19)15-11-4/h8-11H,1-5,12-15H2,6-7H3 |
| InChIKey | UAUXBESVGUJRGK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|