C15H22N4O2 — CID 122583271
3a,6a-dimethyl-3,4,6-tris(prop-2-enyl)-1H-imidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122583271) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3a,6a-dimethyl-3,4,6-tris(prop-2-enyl)-1H-imidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3a,6a-dimethyl-3,4,6-tris(prop-2-enyl)-1H-imidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122583271 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3a,6a-dimethyl-3,4,6-tris(prop-2-enyl)-1H-imidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)N(CC=C)C2(C)N(CC=C)C(=O)NC12C |
| InChI | InChI=1S/C15H22N4O2/c1-6-9-17-12(20)16-14(4)15(17,5)19(11-8-3)13(21)18(14)10-7-2/h6-8H,1-3,9-11H2,4-5H3,(H,16,20) |
| InChIKey | MLLSWSRRXKIVCR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|