C15H17NO2 — CID 67612075
1,3,5,6-tetramethyl-2-prop-2-enylisoindole-4,7-dione (PubChem CID 67612075) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1,3,5,6-tetramethyl-2-prop-2-enylisoindole-4,7-dione.
| Compound Name | 1,3,5,6-tetramethyl-2-prop-2-enylisoindole-4,7-dione |
|---|---|
| PubChem CID | 67612075 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1,3,5,6-tetramethyl-2-prop-2-enylisoindole-4,7-dione |
| SMILES | C=CCn1c(C)c2c(c1C)C(=O)C(C)=C(C)C2=O |
| InChI | InChI=1S/C15H17NO2/c1-6-7-16-10(4)12-13(11(16)5)15(18)9(3)8(2)14(12)17/h6H,1,7H2,2-5H3 |
| InChIKey | XSEOOVIFSRVCSK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|