C6H7NO3S — CID 54224698
4,5-dihydroxy-3-prop-2-enyl-1,3-thiazol-2-one (PubChem CID 54224698) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is 4,5-dihydroxy-3-prop-2-enyl-1,3-thiazol-2-one.
| Compound Name | 4,5-dihydroxy-3-prop-2-enyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54224698 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 4,5-dihydroxy-3-prop-2-enyl-1,3-thiazol-2-one |
| SMILES | C=CCn1c(O)c(O)sc1=O |
| InChI | InChI=1S/C6H7NO3S/c1-2-3-7-4(8)5(9)11-6(7)10/h2,8-9H,1,3H2 |
| InChIKey | QFAQIFDAVCYEGO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|