C14H14N2O2S — CID 46352480
N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)cyclopropanecarboxamide (PubChem CID 46352480) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)cyclopropanecarboxamide.
| Compound Name | N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46352480 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)cyclopropanecarboxamide |
| SMILES | C=CCn1c(=O)sc2cc(NC(=O)C3CC3)ccc21 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-7-16-11-6-5-10(8-12(11)19-14(16)18)15-13(17)9-3-4-9/h2,5-6,8-9H,1,3-4,7H2,(H,15,17) |
| InChIKey | KPFLNFSPLAVZDP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|