C16H12F2N2O3S2 — CID 50800397
2,4-difluoro-N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)benzenesulfonamide (PubChem CID 50800397) has the molecular formula C16H12F2N2O3S2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 50800397 |
| Molecular Formula | C16H12F2N2O3S2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2,4-difluoro-N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)benzenesulfonamide |
| SMILES | C=CCn1c(=O)sc2cc(NS(=O)(=O)c3ccc(F)cc3F)ccc21 |
| InChI | InChI=1S/C16H12F2N2O3S2/c1-2-7-20-13-5-4-11(9-14(13)24-16(20)21)19-25(22,23)15-6-3-10(17)8-12(15)18/h2-6,8-9,19H,1,7H2 |
| InChIKey | XEEABPCFBXNCIX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|