About N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide
N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide (PubChem CID 50839999) has the molecular formula C15H12F2N2O4S3
and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide |
| PubChem CID | 50839999 |
| Molecular Formula | C15H12F2N2O4S3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1nc2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2s1 |
| InChI | InChI=1S/C15H12F2N2O4S3/c1-2-25(20,21)15-18-12-5-4-10(8-13(12)24-15)19-26(22,23)14-6-3-9(16)7-11(14)17/h3-8,19H,2H2,1H3 |
| InChIKey | OAEIJKOOZHKJGP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide?
The IUPAC name of N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide (CID 50839999) is N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide.
What is the SMILES notation for N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide?
The canonical SMILES for N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide is CCS(=O)(=O)c1nc2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2s1.
What is the InChIKey of N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide?
The InChIKey is OAEIJKOOZHKJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O4S3/c1-2-25(20,21)15-18-12-5-4-10(8-13(12)24-15)19-26(22,23)14-6-3-9(16)7-11(14)17/h3-8,19H,2H2,1H3.
What are the key properties of N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide?
N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide has a molecular weight of 418.47 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide is sourced from PubChem (CID 50839999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).