C15H12F2N2O4S3 — CID 50839999
N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide (PubChem CID 50839999) has the molecular formula C15H12F2N2O4S3 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 50839999 |
| Molecular Formula | C15H12F2N2O4S3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | N-(2-ethylsulfonyl-1,3-benzothiazol-6-yl)-2,4-difluorobenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1nc2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2s1 |
| InChI | InChI=1S/C15H12F2N2O4S3/c1-2-25(20,21)15-18-12-5-4-10(8-13(12)24-15)19-26(22,23)14-6-3-9(16)7-11(14)17/h3-8,19H,2H2,1H3 |
| InChIKey | OAEIJKOOZHKJGP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |