C13H6F4N2O2S3 — CID 71584454
4-(1,3-benzothiazol-2-ylsulfanyl)-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 71584454) has the molecular formula C13H6F4N2O2S3 and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71584454 |
| Molecular Formula | C13H6F4N2O2S3 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(Sc2nc3ccccc3s2)c(F)c1F |
| InChI | InChI=1S/C13H6F4N2O2S3/c14-7-9(16)12(24(18,20)21)10(17)8(15)11(7)23-13-19-5-3-1-2-4-6(5)22-13/h1-4H,(H2,18,20,21) |
| InChIKey | YVWIZEXTHJMGAV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|