C20H20N2O3S2 — CID 50800245
N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 50800245) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 50800245 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-(2-oxo-3-prop-2-enyl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | C=CCn1c(=O)sc2cc(NS(=O)(=O)c3ccc4c(c3)CCCC4)ccc21 |
| InChI | InChI=1S/C20H20N2O3S2/c1-2-11-22-18-10-8-16(13-19(18)26-20(22)23)21-27(24,25)17-9-7-14-5-3-4-6-15(14)12-17/h2,7-10,12-13,21H,1,3-6,11H2 |
| InChIKey | VFKUHJXJBSIUFT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|