C23H19N3O2S — CID 3404226
N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-1-carboxamide (PubChem CID 3404226) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-1-carboxamide.
| Compound Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3404226 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-1-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc3ccccc23)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C23H19N3O2S/c1-3-13-26-20-12-11-17(24-15(2)27)14-21(20)29-23(26)25-22(28)19-10-6-8-16-7-4-5-9-18(16)19/h3-12,14H,1,13H2,2H3,(H,24,27)/b25-23- |
| InChIKey | QMOTYHPCYXDRIO-BZZOAKBMSA-N |
| XLogP | 4.74 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|