C22H17N3O4S — CID 3479716
N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide (PubChem CID 3479716) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide.
| Compound Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3479716 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2coc3ccccc3c2=O)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C22H17N3O4S/c1-3-10-25-17-9-8-14(23-13(2)26)11-19(17)30-22(25)24-21(28)16-12-29-18-7-5-4-6-15(18)20(16)27/h3-9,11-12H,1,10H2,2H3,(H,23,26)/b24-22- |
| InChIKey | WUMISVHSPJPZQW-GYHWCHFESA-N |
| XLogP | 3.69 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|