C19H14N2O3S — CID 4106571
N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide (PubChem CID 4106571) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide.
| Compound Name | N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4106571 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2coc3ccccc3c2=O)sc2ccccc21 |
| InChI | InChI=1S/C19H14N2O3S/c1-2-21-14-8-4-6-10-16(14)25-19(21)20-18(23)13-11-24-15-9-5-3-7-12(15)17(13)22/h3-11H,2H2,1H3/b20-19- |
| InChIKey | RUWRVSPLDKABFK-VXPUYCOJSA-N |
| XLogP | 3.57 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |