C21H18N2O3S — CID 7154071
N-(3,4-diethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide (PubChem CID 7154071) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(3,4-diethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide.
| Compound Name | N-(3,4-diethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7154071 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(3,4-diethyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-3-carboxamide |
| SMILES | CCc1cccc2s/c(=N\C(=O)c3coc4ccccc4c3=O)n(CC)c12 |
| InChI | InChI=1S/C21H18N2O3S/c1-3-13-8-7-11-17-18(13)23(4-2)21(27-17)22-20(25)15-12-26-16-10-6-5-9-14(16)19(15)24/h5-12H,3-4H2,1-2H3/b22-21- |
| InChIKey | NMYMREJVKCYNBX-DQRAZIAOSA-N |
| XLogP | 4.13 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |