C20H16F3N3O2S — CID 5207772
N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(trifluoromethyl)benzamide (PubChem CID 5207772) has the molecular formula C20H16F3N3O2S and a molecular weight of 419.43 g/mol. Its IUPAC name is N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 5207772 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-(6-acetamido-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(trifluoromethyl)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(C(F)(F)F)c2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C20H16F3N3O2S/c1-3-9-26-16-8-7-15(24-12(2)27)11-17(16)29-19(26)25-18(28)13-5-4-6-14(10-13)20(21,22)23/h3-8,10-11H,1,9H2,2H3,(H,24,27)/b25-19- |
| InChIKey | QGZKNXZIUGMKCS-PLRJNAJWSA-N |
| XLogP | 4.61 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|