C6H9N5O3 — CID 139913241
1,3-diamino-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 139913241) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is 1,3-diamino-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-diamino-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139913241 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1,3-diamino-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(N)c(=O)n(N)c1=O |
| InChI | InChI=1S/C6H9N5O3/c1-2-3-9-4(12)10(7)6(14)11(8)5(9)13/h2H,1,3,7-8H2 |
| InChIKey | HATJBAXUPHYSJX-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|