C26H37N7O6 — CID 135127033
1-[4-amino-2,2,4-trimethyl-5-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]pentyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 135127033) has the molecular formula C26H37N7O6 and a molecular weight of 543.63 g/mol. Its IUPAC name is 1-[4-amino-2,2,4-trimethyl-5-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]pentyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[4-amino-2,2,4-trimethyl-5-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]pentyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 135127033 |
| Molecular Formula | C26H37N7O6 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 1-[4-amino-2,2,4-trimethyl-5-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]pentyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(C)(C)CC(C)(N)Cn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)c1=O |
| InChI | InChI=1S/C26H37N7O6/c1-8-12-28-19(34)29(13-9-2)22(37)32(21(28)36)17-25(5,6)16-26(7,27)18-33-23(38)30(14-10-3)20(35)31(15-11-4)24(33)39/h8-11H,1-4,12-18,27H2,5-7H3 |
| InChIKey | BAMPXNBZKJXNDX-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|