C14H19N3O2 — CID 143077874
3-but-3-enyl-6-methylidene-1,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4-dione (PubChem CID 143077874) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-but-3-enyl-6-methylidene-1,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 3-but-3-enyl-6-methylidene-1,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 143077874 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-but-3-enyl-6-methylidene-1,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=CCCN1C(=O)N(CC=C)C(=C)N(CC=C)C1=O |
| InChI | InChI=1S/C14H19N3O2/c1-5-8-11-17-13(18)15(9-6-2)12(4)16(10-7-3)14(17)19/h5-7H,1-4,8-11H2 |
| InChIKey | NRTYLWBAEHAUHR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|