C15H20N3O3+ — CID 90198430
1,1,3,5-tetrakis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione (PubChem CID 90198430) has the molecular formula C15H20N3O3+ and a molecular weight of 290.34 g/mol. Its IUPAC name is 1,1,3,5-tetrakis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione.
| Compound Name | 1,1,3,5-tetrakis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione |
|---|---|
| PubChem CID | 90198430 |
| Molecular Formula | C15H20N3O3+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,1,3,5-tetrakis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione |
| SMILES | C=CCN1C(=O)N(CC=C)C(=O)[N+](CC=C)(CC=C)C1=O |
| InChI | InChI=1S/C15H20N3O3/c1-5-9-16-13(19)17(10-6-2)15(21)18(11-7-3,12-8-4)14(16)20/h5-8H,1-4,9-12H2/q+1 |
| InChIKey | FCNAPRQANPUBQN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|