C12H17N3O2 — CID 15051391
1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4-dione (PubChem CID 15051391) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 15051391 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=CCN1CN(CC=C)C(=O)N(CC=C)C1=O |
| InChI | InChI=1S/C12H17N3O2/c1-4-7-13-10-14(8-5-2)12(17)15(9-6-3)11(13)16/h4-6H,1-3,7-10H2 |
| InChIKey | PCDYXJDTBADWSU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|