C7H9NOS — CID 123730959
2-methylidene-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 123730959) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-methylidene-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-methylidene-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123730959 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 2-methylidene-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=C)SCC1=O |
| InChI | InChI=1S/C7H9NOS/c1-3-4-8-6(2)10-5-7(8)9/h3H,1-2,4-5H2 |
| InChIKey | LVBMCTLPSBNPMR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|