About 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one
3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one (PubChem CID 143676783) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one |
| PubChem CID | 143676783 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one |
| SMILES | C=C1SCC(=O)N1C/C=C\C |
| InChI | InChI=1S/C8H11NOS/c1-3-4-5-9-7(2)11-6-8(9)10/h3-4H,2,5-6H2,1H3/b4-3- |
| InChIKey | LHRYKDLGWXWPNZ-ARJAWSKDSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one?
The IUPAC name of 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one (CID 143676783) is 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one is C=C1SCC(=O)N1C/C=C\C.
What is the InChIKey of 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one?
The InChIKey is LHRYKDLGWXWPNZ-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H11NOS/c1-3-4-5-9-7(2)11-6-8(9)10/h3-4H,2,5-6H2,1H3/b4-3-.
What are the key properties of 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one?
3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one has a molecular weight of 169.25 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 143676783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).