C8H11NOS — CID 143676783
3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one (PubChem CID 143676783) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143676783 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 3-[(Z)-but-2-enyl]-2-methylidene-1,3-thiazolidin-4-one |
| SMILES | C=C1SCC(=O)N1C/C=C\C |
| InChI | InChI=1S/C8H11NOS/c1-3-4-5-9-7(2)11-6-8(9)10/h3-4H,2,5-6H2,1H3/b4-3- |
| InChIKey | LHRYKDLGWXWPNZ-ARJAWSKDSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|