C12H14N4O2S2 — CID 173359962
3-but-2-enyl-5-methylidene-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 173359962) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-but-2-enyl-5-methylidene-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-but-2-enyl-5-methylidene-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173359962 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-but-2-enyl-5-methylidene-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C=C1SC(=NN=C2SCC(=O)N2C)N(CC=CC)C1=O |
| InChI | InChI=1S/C12H14N4O2S2/c1-4-5-6-16-10(18)8(2)20-12(16)14-13-11-15(3)9(17)7-19-11/h4-5H,2,6-7H2,1,3H3 |
| InChIKey | OLTQYULTZSXPND-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|